| Name |
12-[(1,3,5-trimethyl-1H-pyrazol-4-yl)sulfonyl]-4,6,12-triazatricyclo[7.2.1.0^{2,7}]dodeca-2(7),3,5-triene
|
| Molecular Formula |
C15H19N5O2S
|
| Molecular Weight |
333.4
|
| Smiles |
Cc1nn(C)c(C)c1S(=O)(=O)N1C2CCC1c1cncnc1C2
|
Cc1nn(C)c(C)c1S(=O)(=O)N1C2CCC1c1cncnc1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.