| Name |
7-(3,4-dimethylphenyl)-2-(2-fluorobenzyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8(2H,7H)-dione
|
| Molecular Formula |
C20H17FN4O2
|
| Molecular Weight |
364.4
|
| Smiles |
Cc1ccc(-n2ccn3c(=O)n(Cc4ccccc4F)nc3c2=O)cc1C
|
Cc1ccc(-n2ccn3c(=O)n(Cc4ccccc4F)nc3c2=O)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.