| Name |
1-((2R,3S,3aR,4aR,5aR,5bS)-5a-(Bis(4-methoxyphenyl)(phenyl)methoxy)-3-fluoro-3a-hydroxyoctahydrocyclopropa[4,5]cyclopenta[1,2-b]furan-2-yl)-5-methylpyrimidine-2,4(1H,3H)-dione
|
| Molecular Formula |
C34H33FN2O7
|
| Molecular Weight |
600.6
|
| Smiles |
COc1ccc(C(OC23CC2CC2(O)C(F)C(n4cc(C)c(=O)[nH]c4=O)OC23)(c2ccccc2)c2ccc(OC)cc2)cc1
|
COc1ccc(C(OC23CC2CC2(O)C(F)C(n4cc(C)c(=O)[nH]c4=O)OC23)(c2ccccc2)c2ccc(OC)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.