| Name |
2-[Bis(2-hydroxyethyl)amino]ethanol;2,4,6,8,9,10-hexaoxa-1lambda5,3lambda5,5lambda5,7lambda5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide
|
| Molecular Formula |
C12H30N2O16P4
|
| Molecular Weight |
582.27
|
| Smiles |
O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3.OCCN(CCO)CCO.OCCN(CCO)CCO
|
O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3.OCCN(CCO)CCO.OCCN(CCO)CCO
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.