| Name |
2-(5-Oxothieno[2,3-e][1,2,3]triazolo[1,5-a]pyrimidin-4(5H)-yl)acetic acid
|
| Molecular Formula |
C9H6N4O3S
|
| Molecular Weight |
250.24
|
| Smiles |
O=C(O)Cn1c(=O)c2sccc2n2nncc12
|
O=C(O)Cn1c(=O)c2sccc2n2nncc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.