| Name |
8-chloro-2-(6-oxo-1,4,5,6-tetrahydropyridazine-3-carbonyl)-3,4-dihydro-1H-dipyrido[1,2-a:4',3'-d]pyrimidin-11(2H)-one
|
| Molecular Formula |
C16H14ClN5O3
|
| Molecular Weight |
359.77
|
| Smiles |
O=C1CCC(C(=O)N2CCc3nc4ccc(Cl)cn4c(=O)c3C2)=NN1
|
O=C1CCC(C(=O)N2CCc3nc4ccc(Cl)cn4c(=O)c3C2)=NN1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.