| Name |
Ethyl 1-(2,2-difluoroethyl)-3-nitro-1H-pyrazole-5-carboxylate
|
| Molecular Formula |
C8H9F2N3O4
|
| Molecular Weight |
249.17
|
| Smiles |
CCOC(=O)c1cc([N+](=O)[O-])nn1CC(F)F
|
CCOC(=O)c1cc([N+](=O)[O-])nn1CC(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.