| Name |
N-(4-chloro-2-fluorophenyl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)-1,3-dioxo-3,5,6,7,8,9-hexahydropyrimido[1,6-a]azepin-2(1H)-yl]acetamide
|
| Molecular Formula |
C20H19ClFN5O4
|
| Molecular Weight |
447.8
|
| Smiles |
Cc1nc(-c2c3n(c(=O)n(CC(=O)Nc4ccc(Cl)cc4F)c2=O)CCCCC3)no1
|
Cc1nc(-c2c3n(c(=O)n(CC(=O)Nc4ccc(Cl)cc4F)c2=O)CCCCC3)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.