| Name |
ethyl 2-(4-nitro-2H-1,2,3-triazol-2-yl)acetate
|
| Molecular Formula |
C6H8N4O4
|
| Molecular Weight |
200.15
|
| Smiles |
CCOC(=O)Cn1ncc([N+](=O)[O-])n1
|
CCOC(=O)Cn1ncc([N+](=O)[O-])n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.