| Name |
3-(4-Fluorophenyl)-5-[6-(4-fluorophenyl)-4H,6H,7H-[1,2,3]triazolo[4,3-C][1,4]oxazin-3-YL]-1,2,4-oxadiazole
|
| Molecular Formula |
C19H13F2N5O2
|
| Molecular Weight |
381.3
|
| Smiles |
Fc1ccc(-c2noc(-c3nnn4c3COC(c3ccc(F)cc3)C4)n2)cc1
|
Fc1ccc(-c2noc(-c3nnn4c3COC(c3ccc(F)cc3)C4)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.