| Name |
(1-Hydroxy-3-(isopentyl(methyl)amino)propane-1,1-diyl)bis(phosphonic acid)
|
| Molecular Formula |
C9H23NO7P2
|
| Molecular Weight |
319.23
|
| Smiles |
CC(C)CCN(C)CCC(O)(P(=O)(O)O)P(=O)(O)O
|
CC(C)CCN(C)CCC(O)(P(=O)(O)O)P(=O)(O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.