| Name |
N-(3,4-dichlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4,7-dioxo-1,2,3,4a,5,6,8,8a-octahydropyrido[2,3-d]pyrimidine-5-carboxamide
|
| Molecular Formula |
C23H23Cl2N5O3
|
| Molecular Weight |
488.4
|
| Smiles |
O=C1CC(C(=O)Nc2ccc(Cl)c(Cl)c2)C2C(=O)NC(N3CCc4ccccc4C3)NC2N1
|
O=C1CC(C(=O)Nc2ccc(Cl)c(Cl)c2)C2C(=O)NC(N3CCc4ccccc4C3)NC2N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.