| Name |
N-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3-(3-oxo-5-sulfanylidene-2,6,6a,7,8,9,10,10a-octahydroimidazo[1,2-c]quinazolin-2-yl)propanamide
|
| Molecular Formula |
C25H33ClN6O2S
|
| Molecular Weight |
517.1
|
| Smiles |
O=C(CCC1N=C2C3CCCCC3NC(=S)N2C1=O)NCCN1CCN(c2cccc(Cl)c2)CC1
|
O=C(CCC1N=C2C3CCCCC3NC(=S)N2C1=O)NCCN1CCN(c2cccc(Cl)c2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.