| Name |
Thieno[2,3-c]pyridine-2-carboxamide,7-amino-4-(4'-methyl[1,1'-biphenyl]-3-yl)-
|
| Molecular Formula |
C21H17N3OS
|
| Molecular Weight |
359.4
|
| Smiles |
Cc1ccc(-c2cccc(-c3cnc(N)c4sc(C(N)=O)cc34)c2)cc1
|
Cc1ccc(-c2cccc(-c3cnc(N)c4sc(C(N)=O)cc34)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.