| Name |
4-(3,4-Difluorophenyl)-2-methyl-2,3,4,5-tetrahydro-1,4-benzoxazepin-3-one
|
| Molecular Formula |
C16H13F2NO2
|
| Molecular Weight |
289.28
|
| Smiles |
CC1Oc2ccccc2CN(c2ccc(F)c(F)c2)C1=O
|
CC1Oc2ccccc2CN(c2ccc(F)c(F)c2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.