| Name |
6-(bromomethyl)-3-phenyl-5H,6H-[1,2,4]triazolo[3,4-b][1,3]thiazole
|
| Molecular Formula |
C11H10BrN3S
|
| Molecular Weight |
296.19
|
| Smiles |
BrCC1Cn2c(nnc2-c2ccccc2)S1
|
BrCC1Cn2c(nnc2-c2ccccc2)S1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.