| Name |
N-(pyridin-3-yl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-carboxamide
|
| Molecular Formula |
C12H12N4O2
|
| Molecular Weight |
244.25
|
| Smiles |
O=C(Nc1cccnc1)c1cnn2c1OCCC2
|
O=C(Nc1cccnc1)c1cnn2c1OCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.