| Name |
(7,7-Dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)(3-methyl-2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methanone
|
| Molecular Formula |
C18H23NO5
|
| Molecular Weight |
333.4
|
| Smiles |
CC1Oc2ccccc2OC1C(=O)N1CC2(COC(C)(C)OC2)C1
|
CC1Oc2ccccc2OC1C(=O)N1CC2(COC(C)(C)OC2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.