| Name |
2-[3-[(4-chlorophenyl)methyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidin-1-yl]-N-(2-fluorophenyl)acetamide
|
| Molecular Formula |
C22H22ClFN4O3
|
| Molecular Weight |
444.9
|
| Smiles |
O=C(CN1C(=O)N(Cc2ccc(Cl)cc2)C(=O)C2CCCNC21)Nc1ccccc1F
|
O=C(CN1C(=O)N(Cc2ccc(Cl)cc2)C(=O)C2CCCNC21)Nc1ccccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.