| Name |
4-Benzyl-1-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-5-one
|
| Molecular Formula |
C27H34N8O2
|
| Molecular Weight |
502.6
|
| Smiles |
O=C(CCC1=NNC2N(Cc3ccccc3)C(=O)C3CCCCC3N12)N1CCN(c2ncccn2)CC1
|
O=C(CCC1=NNC2N(Cc3ccccc3)C(=O)C3CCCCC3N12)N1CCN(c2ncccn2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.