| Name |
2,6-Bis(4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl)pyridine
|
| Molecular Formula |
C35H29N5
|
| Molecular Weight |
519.6
|
| Smiles |
c1ccc(C2N=C(c3cccc(C4=NC(c5ccccc5)C(c5ccccc5)N4)n3)NC2c2ccccc2)cc1
|
c1ccc(C2N=C(c3cccc(C4=NC(c5ccccc5)C(c5ccccc5)N4)n3)NC2c2ccccc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.