| Name |
Methyl 3-[6-(4-methoxyphenyl)-4,7-dimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-2-yl]propanoate
|
| Molecular Formula |
C20H23N5O5
|
| Molecular Weight |
413.4
|
| Smiles |
COC(=O)CCN1C(=O)C2C(N=C3N(c4ccc(OC)cc4)C(C)=CN32)N(C)C1=O
|
COC(=O)CCN1C(=O)C2C(N=C3N(c4ccc(OC)cc4)C(C)=CN32)N(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.