| Name |
2'-Chloro-4'-methyl-5'H-spiro[cyclohexane-1,6'-thieno[2,3-D]pyrimidine]
|
| Molecular Formula |
C12H15ClN2S
|
| Molecular Weight |
254.78
|
| Smiles |
Cc1nc(Cl)nc2c1CC1(CCCCC1)S2
|
Cc1nc(Cl)nc2c1CC1(CCCCC1)S2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.