| Name |
2-(3-Fluorophenyl)-6,7-dihydropyrazolo[1,5-A]pyrazin-4(5H)-one
|
| Molecular Formula |
C12H10FN3O
|
| Molecular Weight |
231.23
|
| Smiles |
O=C1NCCn2nc(-c3cccc(F)c3)cc21
|
O=C1NCCn2nc(-c3cccc(F)c3)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.