| Name |
N~5~-(Diaminomethylidene)-L-ornithyl-L-valyl-L-prolyl-L-histidyl-L-seryl-L-cysteinyl-L-asparagine
|
| Molecular Formula |
C32H53N13O10S
|
| Molecular Weight |
811.9
|
| Smiles |
CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)NC(CS)C(=O)NC(CC(N)=O)C(=O)O
|
CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)NC(CS)C(=O)NC(CC(N)=O)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.