| Name |
5-[(2-chlorophenyl)amino]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-1,2,3-triazole-4-carboxamide
|
| Molecular Formula |
C17H18ClN5O3
|
| Molecular Weight |
375.8
|
| Smiles |
O=C(Nc1ccc2c(c1)OCCO2)C1NNNC1Nc1ccccc1Cl
|
O=C(Nc1ccc2c(c1)OCCO2)C1NNNC1Nc1ccccc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.