| Name |
5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-2-(trimethylsilyl)thieno[2,3-b]pyridine
|
| Molecular Formula |
C16H24BNO2SSi
|
| Molecular Weight |
333.3
|
| Smiles |
CC1(C)OB(c2cnc3sc([Si](C)(C)C)cc3c2)OC1(C)C
|
CC1(C)OB(c2cnc3sc([Si](C)(C)C)cc3c2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.