| Name |
4-Amino-1,2-dihydroisoquinolin-3(4H)-one dihydrobromide
|
| Molecular Formula |
C9H12Br2N2O
|
| Molecular Weight |
324.01
|
| Smiles |
Br.Br.NC1C(=O)NCc2ccccc21
|
Br.Br.NC1C(=O)NCc2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.