| Name |
N-{[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl}-N-cyanoaniline
|
| Molecular Formula |
C17H12ClN3O
|
| Molecular Weight |
309.7
|
| Smiles |
N#CN(Cc1ncc(-c2cccc(Cl)c2)o1)c1ccccc1
|
N#CN(Cc1ncc(-c2cccc(Cl)c2)o1)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.