| Name |
tert-Butyl (4aS,9aS)-3-oxooctahydro-[1,4]oxazino[2,3-d]azepine-7(2H)-carboxylate
|
| Molecular Formula |
C13H22N2O4
|
| Molecular Weight |
270.32
|
| Smiles |
CC(C)(C)OC(=O)N1CCC2NC(=O)COC2CC1
|
CC(C)(C)OC(=O)N1CCC2NC(=O)COC2CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.