| Name |
[6-methyl-2-(1H-1,2,4-triazol-1-yl)pyridin-3-yl]methanamine dihydrochloride
|
| Molecular Formula |
C9H13Cl2N5
|
| Molecular Weight |
262.14
|
| Smiles |
Cc1ccc(CN)c(-n2cncn2)n1.Cl.Cl
|
Cc1ccc(CN)c(-n2cncn2)n1.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.