| Name |
N-tert-Butyloxycarbonyl Aminomalamido-N,N'-propionic Acid di-tert-Butyl Diester
|
| Molecular Formula |
C22H39N3O8
|
| Molecular Weight |
473.6
|
| Smiles |
CC(C)(C)OC(=O)CCNC(=O)C(NC(=O)OC(C)(C)C)C(=O)NCCC(=O)OC(C)(C)C
|
CC(C)(C)OC(=O)CCNC(=O)C(NC(=O)OC(C)(C)C)C(=O)NCCC(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.