| Name |
Butanoic acid, 2-methyl-, 12-hydroxy-1-(2-hydroxyethyl)-2,4,10-dodecatriene-6,8-diynyl ester, (E,E,E)-
|
| Molecular Formula |
C19H24O4
|
| Molecular Weight |
316.4
|
| Smiles |
CC(C)CC(=O)OC(C=CC=CC#CC#CC=CCO)CCO
|
CC(C)CC(=O)OC(C=CC=CC#CC#CC=CCO)CCO
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.