| Name |
2-{2-oxo-10-thia-1,8-diazatricyclo[7.3.0.0^{3,7}]dodeca-3(7),8-dien-12-yl}-N-{2-[6-oxo-3-(1H-1,2,4-triazol-1-yl)-1,6-dihydropyridazin-1-yl]ethyl}acetamide
|
| Molecular Formula |
C19H20N8O3S
|
| Molecular Weight |
440.5
|
| Smiles |
O=C(CC1CSc2nc3c(c(=O)n21)CCC3)NCCn1nc(-n2cncn2)ccc1=O
|
O=C(CC1CSc2nc3c(c(=O)n21)CCC3)NCCn1nc(-n2cncn2)ccc1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.