| Name |
(4-(3,5-dimethoxyphenyl)-1,1-dioxido-4H-benzo[b][1,4]thiazin-2-yl)(piperidin-1-yl)methanone
|
| Molecular Formula |
C22H24N2O5S
|
| Molecular Weight |
428.5
|
| Smiles |
COc1cc(OC)cc(N2C=C(C(=O)N3CCCCC3)S(=O)(=O)c3ccccc32)c1
|
COc1cc(OC)cc(N2C=C(C(=O)N3CCCCC3)S(=O)(=O)c3ccccc32)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.