| Name |
6-({[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl}thio)-7-(3-methoxypropyl)[1,3]dioxolo[4,5-g]quinazolin-8(7H)-one
|
| Molecular Formula |
C22H19ClN4O5S
|
| Molecular Weight |
486.9
|
| Smiles |
COCCCn1c(SCc2nc(-c3cccc(Cl)c3)no2)nc2cc3c(cc2c1=O)OCO3
|
COCCCn1c(SCc2nc(-c3cccc(Cl)c3)no2)nc2cc3c(cc2c1=O)OCO3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.