| Name |
N-(6,7-dihydro-[1,4]dioxino[2',3':4,5]benzo[1,2-d]thiazol-2-yl)-4-(2,5-dioxopyrrolidin-1-yl)-N-(pyridin-3-ylmethyl)benzamide
|
| Molecular Formula |
C26H20N4O5S
|
| Molecular Weight |
500.5
|
| Smiles |
O=C(c1ccc(N2C(=O)CCC2=O)cc1)N(Cc1cccnc1)c1nc2cc3c(cc2s1)OCCO3
|
O=C(c1ccc(N2C(=O)CCC2=O)cc1)N(Cc1cccnc1)c1nc2cc3c(cc2s1)OCCO3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.