| Name |
N-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-7-phenyl-7H-pyrazolo[3,4-d][1,2,3]triazin-4-amine
|
| Molecular Formula |
C18H14N6O2
|
| Molecular Weight |
346.3
|
| Smiles |
c1ccc(-n2ncc3c(Nc4ccc5c(c4)OCCO5)nnnc32)cc1
|
c1ccc(-n2ncc3c(Nc4ccc5c(c4)OCCO5)nnnc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.