| Name |
2-chloro-4-fluoro-N-{2-oxo-9-oxa-1-azatricyclo[10.4.0.0^{3,8}]hexadeca-3,5,7-trien-5-yl}benzamide
|
| Molecular Formula |
C21H20ClFN2O3
|
| Molecular Weight |
402.8
|
| Smiles |
O=C(Nc1ccc2c(c1)C(=O)N1CCCCC1CCO2)c1ccc(F)cc1Cl
|
O=C(Nc1ccc2c(c1)C(=O)N1CCCCC1CCO2)c1ccc(F)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.