| Name |
1-(5-Chloro-2-methoxyphenyl)-3-{2-oxo-9-oxa-1-azatricyclo[10.4.0.0^{3,8}]hexadeca-3,5,7-trien-5-yl}urea
|
| Molecular Formula |
C22H24ClN3O4
|
| Molecular Weight |
429.9
|
| Smiles |
COc1ccc(Cl)cc1NC(=O)Nc1ccc2c(c1)C(=O)N1CCCCC1CCO2
|
COc1ccc(Cl)cc1NC(=O)Nc1ccc2c(c1)C(=O)N1CCCCC1CCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.