| Name |
2-({2-[2-(benzylcarbamoyl)ethyl]-3-oxo-2H,3H-imidazo[1,2-c]quinazolin-5-yl}sulfanyl)-N-[(4-methylphenyl)methyl]butanamide
|
| Molecular Formula |
C32H33N5O3S
|
| Molecular Weight |
567.7
|
| Smiles |
CCC(SC1=Nc2ccccc2C2=NC(CCC(=O)NCc3ccccc3)C(=O)N12)C(=O)NCc1ccc(C)cc1
|
CCC(SC1=Nc2ccccc2C2=NC(CCC(=O)NCc3ccccc3)C(=O)N12)C(=O)NCc1ccc(C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.