| Name |
3-[5-({[(3-methoxyphenyl)carbamoyl]methyl}sulfanyl)-3-oxo-2H,3H-imidazo[1,2-c]quinazolin-2-yl]-N-[(4-methoxyphenyl)methyl]propanamide
|
| Molecular Formula |
C30H29N5O5S
|
| Molecular Weight |
571.6
|
| Smiles |
COc1ccc(CNC(=O)CCC2N=C3c4ccccc4N=C(SCC(=O)Nc4cccc(OC)c4)N3C2=O)cc1
|
COc1ccc(CNC(=O)CCC2N=C3c4ccccc4N=C(SCC(=O)Nc4cccc(OC)c4)N3C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.