| Name |
4-Chloro-2-cyclohexyl-5,6-dimethylthieno[2,3-d]pyrimidine
|
| Molecular Formula |
C14H17ClN2S
|
| Molecular Weight |
280.8
|
| Smiles |
Cc1sc2nc(C3CCCCC3)nc(Cl)c2c1C
|
Cc1sc2nc(C3CCCCC3)nc(Cl)c2c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.