| Name |
Sodium 2-{2-[(3-chlorophenyl)methyl]-1,3-thiazol-4-yl}acetate
|
| Molecular Formula |
C12H9ClNNaO2S
|
| Molecular Weight |
289.71
|
| Smiles |
O=C([O-])Cc1csc(Cc2cccc(Cl)c2)n1.[Na+]
|
O=C([O-])Cc1csc(Cc2cccc(Cl)c2)n1.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.