| Name |
3-(3-Bromophenyl)-6-({[3-(3,4-dimethylphenyl)-1,2,4-oxadiazol-5-yl]methyl}thio)pyridazine
|
| Molecular Formula |
C21H17BrN4OS
|
| Molecular Weight |
453.4
|
| Smiles |
Cc1ccc(-c2noc(CSc3ccc(-c4cccc(Br)c4)nn3)n2)cc1C
|
Cc1ccc(-c2noc(CSc3ccc(-c4cccc(Br)c4)nn3)n2)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.