| Name | Methyl 2-(3,5-di(pyridin-4-yl)-1H-1,2,4-triazol-1-yl)acetate | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C15H13N5O2 | 
                        
                        
                            | Molecular Weight | 295.30 | 
                        
                        
                            | Smiles | COC(=O)Cn1nc(-c2ccncc2)nc1-c1ccncc1 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        COC(=O)Cn1nc(-c2ccncc2)nc1-c1ccncc1
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.