| Name |
2-{[4-(Chloromethyl)-1,3-thiazol-2-yl]methyl}-1,2-dihydrophthalazin-1-one
|
| Molecular Formula |
C13H10ClN3OS
|
| Molecular Weight |
291.76
|
| Smiles |
O=c1c2ccccc2cnn1Cc1nc(CCl)cs1
|
O=c1c2ccccc2cnn1Cc1nc(CCl)cs1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.