| Name |
3,5-dimethyl-N-(2-{5-[(3-methylphenyl)methyl]-4-oxo-1H,4H,5H-pyrazolo[3,4-d]pyrimidin-1-yl}ethyl)benzamide
|
| Molecular Formula |
C24H25N5O2
|
| Molecular Weight |
415.5
|
| Smiles |
Cc1cccc(Cn2cnc3c(cnn3CCNC(=O)c3cc(C)cc(C)c3)c2=O)c1
|
Cc1cccc(Cn2cnc3c(cnn3CCNC(=O)c3cc(C)cc(C)c3)c2=O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.