| Name |
2-(3-methyl-1H-1,2,4-triazol-5-yl)-8-(4H-1,2,4-triazol-4-yl)pyrido[4,3-b][1,6]naphthyridine-1,9(2H,8H)-dione
|
| Molecular Formula |
C16H11N9O2
|
| Molecular Weight |
361.32
|
| Smiles |
Cc1nc(-n2ccc3nc4ccn(-n5cnnc5)c(=O)c4cc3c2=O)n[nH]1
|
Cc1nc(-n2ccc3nc4ccn(-n5cnnc5)c(=O)c4cc3c2=O)n[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.