| Name |
(1R,5S)-3-(3-Oxo-butyl)-1,2,3,4,5,6-hexahydro-1,5-methano-pyrido[1,2-a][1,5]diazocin-8-one
|
| Molecular Formula |
C15H20N2O2
|
| Molecular Weight |
260.33
|
| Smiles |
CC(=O)CCN1CC2CC(C1)c1cccc(=O)n1C2
|
CC(=O)CCN1CC2CC(C1)c1cccc(=O)n1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.